C28H48OSe — CID 133082270
(3S,8S,9S,10S,13R,14S,17R)-13-methyl-10-(methyl(75Se)selanylmethyl)-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 133082270) has the molecular formula C28H48OSe and a molecular weight of 475.61 g/mol. Its IUPAC name is (3S,8S,9S,10S,13R,14S,17R)-13-methyl-10-(methyl(75Se)selanylmethyl)-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10S,13R,14S,17R)-13-methyl-10-(methyl(75Se)selanylmethyl)-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 133082270 |
| Molecular Formula | C28H48OSe |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | (3S,8S,9S,10S,13R,14S,17R)-13-methyl-10-(methyl(75Se)selanylmethyl)-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[75Se]C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C28H48OSe/c1-19(2)7-6-8-20(3)24-11-12-25-23-10-9-21-17-22(29)13-16-28(21,18-30-5)26(23)14-15-27(24,25)4/h9,19-20,22-26,29H,6-8,10-18H2,1-5H3/t20-,22+,23+,24-,25+,26+,27-,28-/m1/s1/i30-4 |
| InChIKey | FRGQAIOSZCWJMG-KEJGKVHPSA-N |
| XLogP | 7.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|