About 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile
4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile (PubChem CID 13308370) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile.
Molecular Properties
| Compound Name | 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile |
| PubChem CID | 13308370 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile |
| SMILES | CC1=C(C)CC(C#N)SC1 |
| InChI | InChI=1S/C8H11NS/c1-6-3-8(4-9)10-5-7(6)2/h8H,3,5H2,1-2H3 |
| InChIKey | AMZPIHBHKREZRY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile?
The IUPAC name of 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile (CID 13308370) is 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile.
What is the SMILES notation for 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile?
The canonical SMILES for 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile is CC1=C(C)CC(C#N)SC1.
What is the InChIKey of 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile?
The InChIKey is AMZPIHBHKREZRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-6-3-8(4-9)10-5-7(6)2/h8H,3,5H2,1-2H3.
What are the key properties of 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile?
4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile has a molecular weight of 153.25 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carbonitrile is sourced from PubChem (CID 13308370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).