C5H5F8N — CID 13308385
2,2,3,3,4,4,5,5-octafluoropentan-1-amine (PubChem CID 13308385) has the molecular formula C5H5F8N and a molecular weight of 231.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentan-1-amine.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentan-1-amine |
|---|---|
| PubChem CID | 13308385 |
| Molecular Formula | C5H5F8N |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentan-1-amine |
| SMILES | NCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C5H5F8N/c6-2(7)4(10,11)5(12,13)3(8,9)1-14/h2H,1,14H2 |
| InChIKey | QVOJCUNXAFRGOD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|