C20H24N8OS — CID 133083914
(18,18-dimethyl-14-piperidin-1-yl-17-oxa-11-thia-3,5,6,8,13-pentazapentacyclo[10.8.0.02,10.05,9.015,20]icosa-1(12),2(10),3,6,8,13,15(20)-heptaen-4-yl)hydrazine (PubChem CID 133083914) has the molecular formula C20H24N8OS and a molecular weight of 424.53 g/mol. Its IUPAC name is (18,18-dimethyl-14-piperidin-1-yl-17-oxa-11-thia-3,5,6,8,13-pentazapentacyclo[10.8.0.02,10.05,9.015,20]icosa-1(12),2(10),3,6,8,13,15(20)-heptaen-4-yl)hydrazine.
| Compound Name | (18,18-dimethyl-14-piperidin-1-yl-17-oxa-11-thia-3,5,6,8,13-pentazapentacyclo[10.8.0.02,10.05,9.015,20]icosa-1(12),2(10),3,6,8,13,15(20)-heptaen-4-yl)hydrazine |
|---|---|
| PubChem CID | 133083914 |
| Molecular Formula | C20H24N8OS |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (18,18-dimethyl-14-piperidin-1-yl-17-oxa-11-thia-3,5,6,8,13-pentazapentacyclo[10.8.0.02,10.05,9.015,20]icosa-1(12),2(10),3,6,8,13,15(20)-heptaen-4-yl)hydrazine |
| SMILES | CC1(C)Cc2c(c(N3CCCCC3)nc3sc4c(nc(NN)n5ncnc45)c23)CO1 |
| InChI | InChI=1S/C20H24N8OS/c1-20(2)8-11-12(9-29-20)16(27-6-4-3-5-7-27)25-18-13(11)14-15(30-18)17-22-10-23-28(17)19(24-14)26-21/h10H,3-9,21H2,1-2H3,(H,24,26) |
| InChIKey | NIVRYEDEQJUTPF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|