C11H14F3N3O3 — CID 133086133
ethyl 2-[5-amino-4-(aminomethyl)-6-(trifluoromethoxy)-2-pyridinyl]acetate (PubChem CID 133086133) has the molecular formula C11H14F3N3O3 and a molecular weight of 293.25 g/mol. Its IUPAC name is ethyl 2-[5-amino-4-(aminomethyl)-6-(trifluoromethoxy)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-amino-4-(aminomethyl)-6-(trifluoromethoxy)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 133086133 |
| Molecular Formula | C11H14F3N3O3 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | ethyl 2-[5-amino-4-(aminomethyl)-6-(trifluoromethoxy)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(CN)c(N)c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C11H14F3N3O3/c1-2-19-8(18)4-7-3-6(5-15)9(16)10(17-7)20-11(12,13)14/h3H,2,4-5,15-16H2,1H3 |
| InChIKey | JZVLHDUUQGFFNY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |