C11H4F5IN2 — CID 133086481
3-iodo-5-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine (PubChem CID 133086481) has the molecular formula C11H4F5IN2 and a molecular weight of 386.06 g/mol. Its IUPAC name is 3-iodo-5-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine.
| Compound Name | 3-iodo-5-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133086481 |
| Molecular Formula | C11H4F5IN2 |
| Molecular Weight | 386.06 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | 3-iodo-5-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine |
| SMILES | Nc1ncc(-c2c(F)c(F)c(F)c(F)c2F)cc1I |
| InChI | InChI=1S/C11H4F5IN2/c12-6-5(3-1-4(17)11(18)19-2-3)7(13)9(15)10(16)8(6)14/h1-2H,(H2,18,19) |
| InChIKey | XMBQXAFEGDMKDV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.06 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|