C13H6F5N3 — CID 133086539
2-[6-amino-5-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]acetonitrile (PubChem CID 133086539) has the molecular formula C13H6F5N3 and a molecular weight of 299.20 g/mol. Its IUPAC name is 2-[6-amino-5-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[6-amino-5-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 133086539 |
| Molecular Formula | C13H6F5N3 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-[6-amino-5-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1ccc(-c2c(F)c(F)c(F)c(F)c2F)c(N)n1 |
| InChI | InChI=1S/C13H6F5N3/c14-8-7(9(15)11(17)12(18)10(8)16)6-2-1-5(3-4-19)21-13(6)20/h1-2H,3H2,(H2,20,21) |
| InChIKey | FPMRZKZZHJUEFB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|