About 2-(dichloromethyl)furan
2-(dichloromethyl)furan (PubChem CID 13308664) has the molecular formula C5H4Cl2O
and a molecular weight of 150.99 g/mol. Its IUPAC name is 2-(dichloromethyl)furan.
Molecular Properties
| Compound Name | 2-(dichloromethyl)furan |
| PubChem CID | 13308664 |
| Molecular Formula | C5H4Cl2O |
| Molecular Weight | 150.99 g/mol |
| Exact Mass | 149.96 |
| IUPAC Name | 2-(dichloromethyl)furan |
| SMILES | ClC(Cl)c1ccco1 |
| InChI | InChI=1S/C5H4Cl2O/c6-5(7)4-2-1-3-8-4/h1-3,5H |
| InChIKey | IDQMVBRXEUQKQI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.99 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dichloromethyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dichloromethyl)furan?
The IUPAC name of 2-(dichloromethyl)furan (CID 13308664) is 2-(dichloromethyl)furan.
What is the SMILES notation for 2-(dichloromethyl)furan?
The canonical SMILES for 2-(dichloromethyl)furan is ClC(Cl)c1ccco1.
What is the InChIKey of 2-(dichloromethyl)furan?
The InChIKey is IDQMVBRXEUQKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl2O/c6-5(7)4-2-1-3-8-4/h1-3,5H.
What are the key properties of 2-(dichloromethyl)furan?
2-(dichloromethyl)furan has a molecular weight of 150.99 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dichloromethyl)furan is sourced from PubChem (CID 13308664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).