6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid

C12H8F2N2O2 — CID 133086688

IUPAC6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid
SMILESNc1nc(C(=O)O)ccc1-c1cccc(F)c1F
InChIInChI=1S/C12H8F2N2O2/c13-8-3-1-2-6(10(8)14)7-4-5-9(12(17)18)16-11(7)15/h1-5H,(H2,15,16)(H,17,18)
InChIKeyPIYSBRBMYZDRIR-UHFFFAOYSA-N
MW250.20 g/mol
LogP2.31
Rot. Bonds2

About 6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid

6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid (PubChem CID 133086688) has the molecular formula C12H8F2N2O2 and a molecular weight of 250.20 g/mol. Its IUPAC name is 6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid
PubChem CID133086688
Molecular FormulaC12H8F2N2O2
Molecular Weight250.20 g/mol
Exact Mass250.06
IUPAC Name6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid
SMILESNc1nc(C(=O)O)ccc1-c1cccc(F)c1F
InChIInChI=1S/C12H8F2N2O2/c13-8-3-1-2-6(10(8)14)7-4-5-9(12(17)18)16-11(7)15/h1-5H,(H2,15,16)(H,17,18)
InChIKeyPIYSBRBMYZDRIR-UHFFFAOYSA-N
XLogP2.31
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.20
LogP ≤ 52.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid?
The IUPAC name of 6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid (CID 133086688) is 6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid.
What is the SMILES notation for 6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid?
The canonical SMILES for 6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid is Nc1nc(C(=O)O)ccc1-c1cccc(F)c1F.
What is the InChIKey of 6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid?
The InChIKey is PIYSBRBMYZDRIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2N2O2/c13-8-3-1-2-6(10(8)14)7-4-5-9(12(17)18)16-11(7)15/h1-5H,(H2,15,16)(H,17,18).
What are the key properties of 6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid?
6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid has a molecular weight of 250.20 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-(2,3-difluorophenyl)pyridine-2-carboxylic acid is sourced from PubChem (CID 133086688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).