C9H7F5N2O — CID 133086960
3-(aminomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-2-carbaldehyde (PubChem CID 133086960) has the molecular formula C9H7F5N2O and a molecular weight of 254.16 g/mol. Its IUPAC name is 3-(aminomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-2-carbaldehyde.
| Compound Name | 3-(aminomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 133086960 |
| Molecular Formula | C9H7F5N2O |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-(aminomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-2-carbaldehyde |
| SMILES | NCc1c(C=O)ncc(C(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C9H7F5N2O/c10-8(11)7-4(1-15)6(3-17)16-2-5(7)9(12,13)14/h2-3,8H,1,15H2 |
| InChIKey | LNMLAVHJRVKNQZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|