5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid

C12H8Cl2N2O2 — CID 133087184

IUPAC5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid
SMILESNc1cc(C(=O)O)cnc1-c1ccc(Cl)cc1Cl
InChIInChI=1S/C12H8Cl2N2O2/c13-7-1-2-8(9(14)4-7)11-10(15)3-6(5-16-11)12(17)18/h1-5H,15H2,(H,17,18)
InChIKeyAECZVNCCGYKFKJ-UHFFFAOYSA-N
MW283.11 g/mol
LogP3.34
Rot. Bonds2

About 5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid

5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid (PubChem CID 133087184) has the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. Its IUPAC name is 5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid
PubChem CID133087184
Molecular FormulaC12H8Cl2N2O2
Molecular Weight283.11 g/mol
Exact Mass282.00
IUPAC Name5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid
SMILESNc1cc(C(=O)O)cnc1-c1ccc(Cl)cc1Cl
InChIInChI=1S/C12H8Cl2N2O2/c13-7-1-2-8(9(14)4-7)11-10(15)3-6(5-16-11)12(17)18/h1-5H,15H2,(H,17,18)
InChIKeyAECZVNCCGYKFKJ-UHFFFAOYSA-N
XLogP3.34
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.11
LogP ≤ 53.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid?
The IUPAC name of 5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid (CID 133087184) is 5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid.
What is the SMILES notation for 5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid?
The canonical SMILES for 5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid is Nc1cc(C(=O)O)cnc1-c1ccc(Cl)cc1Cl.
What is the InChIKey of 5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid?
The InChIKey is AECZVNCCGYKFKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2N2O2/c13-7-1-2-8(9(14)4-7)11-10(15)3-6(5-16-11)12(17)18/h1-5H,15H2,(H,17,18).
What are the key properties of 5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid?
5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid has a molecular weight of 283.11 g/mol, XLogP of 3.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-(2,4-dichlorophenyl)pyridine-3-carboxylic acid is sourced from PubChem (CID 133087184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).