C13H8Cl3NO2 — CID 133088005
2-[5-chloro-2-(2,6-dichlorophenyl)-3-pyridinyl]acetic acid (PubChem CID 133088005) has the molecular formula C13H8Cl3NO2 and a molecular weight of 316.57 g/mol. Its IUPAC name is 2-[5-chloro-2-(2,6-dichlorophenyl)-3-pyridinyl]acetic acid.
| Compound Name | 2-[5-chloro-2-(2,6-dichlorophenyl)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 133088005 |
| Molecular Formula | C13H8Cl3NO2 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 2-[5-chloro-2-(2,6-dichlorophenyl)-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(Cl)cnc1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H8Cl3NO2/c14-8-4-7(5-11(18)19)13(17-6-8)12-9(15)2-1-3-10(12)16/h1-4,6H,5H2,(H,18,19) |
| InChIKey | WUGYOZGWWJYQIJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |