C9H8ClF2NO2 — CID 133088360
methyl 2-[5-chloro-4-(difluoromethyl)-2-pyridinyl]acetate (PubChem CID 133088360) has the molecular formula C9H8ClF2NO2 and a molecular weight of 235.62 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-(difluoromethyl)-2-pyridinyl]acetate.
| Compound Name | methyl 2-[5-chloro-4-(difluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 133088360 |
| Molecular Formula | C9H8ClF2NO2 |
| Molecular Weight | 235.62 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | methyl 2-[5-chloro-4-(difluoromethyl)-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cc(C(F)F)c(Cl)cn1 |
| InChI | InChI=1S/C9H8ClF2NO2/c1-15-8(14)3-5-2-6(9(11)12)7(10)4-13-5/h2,4,9H,3H2,1H3 |
| InChIKey | VPNYGRHTEVJFCE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |