C11H3F6NS — CID 133088664
3-fluoro-5-(2,3,4,5,6-pentafluorophenyl)-1H-pyridine-2-thione (PubChem CID 133088664) has the molecular formula C11H3F6NS and a molecular weight of 295.21 g/mol. Its IUPAC name is 3-fluoro-5-(2,3,4,5,6-pentafluorophenyl)-1H-pyridine-2-thione.
| Compound Name | 3-fluoro-5-(2,3,4,5,6-pentafluorophenyl)-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 133088664 |
| Molecular Formula | C11H3F6NS |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 3-fluoro-5-(2,3,4,5,6-pentafluorophenyl)-1H-pyridine-2-thione |
| SMILES | Fc1c(F)c(F)c(-c2c[nH]c(=S)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C11H3F6NS/c12-4-1-3(2-18-11(4)19)5-6(13)8(15)10(17)9(16)7(5)14/h1-2H,(H,18,19) |
| InChIKey | MCAOHFMYYHPMNY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|