C12H5F6NO — CID 133088761
[6-fluoro-2-(2,3,4,5,6-pentafluorophenyl)-3-pyridinyl]methanol (PubChem CID 133088761) has the molecular formula C12H5F6NO and a molecular weight of 293.17 g/mol. Its IUPAC name is [6-fluoro-2-(2,3,4,5,6-pentafluorophenyl)-3-pyridinyl]methanol.
| Compound Name | [6-fluoro-2-(2,3,4,5,6-pentafluorophenyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 133088761 |
| Molecular Formula | C12H5F6NO |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | [6-fluoro-2-(2,3,4,5,6-pentafluorophenyl)-3-pyridinyl]methanol |
| SMILES | OCc1ccc(F)nc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H5F6NO/c13-5-2-1-4(3-20)12(19-5)6-7(14)9(16)11(18)10(17)8(6)15/h1-2,20H,3H2 |
| InChIKey | CMHJTOXVSPSMAC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|