C8H13N — CID 13308887
3,5,6,7,8,8a-hexahydroindolizine (PubChem CID 13308887) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 3,5,6,7,8,8a-hexahydroindolizine.
| Compound Name | 3,5,6,7,8,8a-hexahydroindolizine |
|---|---|
| PubChem CID | 13308887 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 3,5,6,7,8,8a-hexahydroindolizine |
| SMILES | C1=CC2CCCCN2C1 |
| InChI | InChI=1S/C8H13N/c1-2-6-9-7-3-5-8(9)4-1/h3,5,8H,1-2,4,6-7H2 |
| InChIKey | ZWZQSLQJKCKOIM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|