C12H19NO4 — CID 13308893
[(1S,2R,8aS)-1-acetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate (PubChem CID 13308893) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is [(1S,2R,8aS)-1-acetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate.
| Compound Name | [(1S,2R,8aS)-1-acetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate |
|---|---|
| PubChem CID | 13308893 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | [(1S,2R,8aS)-1-acetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)CN2CCCC[C@@H]12 |
| InChI | InChI=1S/C12H19NO4/c1-8(14)16-11-7-13-6-4-3-5-10(13)12(11)17-9(2)15/h10-12H,3-7H2,1-2H3/t10-,11+,12-/m0/s1 |
| InChIKey | VAWLYESBWKGRCQ-TUAOUCFPSA-N |
| XLogP | 0.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |