C19H10F7N — CID 133089510
4-fluoro-3,5-bis[2-(trifluoromethyl)phenyl]pyridine (PubChem CID 133089510) has the molecular formula C19H10F7N and a molecular weight of 385.28 g/mol. Its IUPAC name is 4-fluoro-3,5-bis[2-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 4-fluoro-3,5-bis[2-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 133089510 |
| Molecular Formula | C19H10F7N |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 4-fluoro-3,5-bis[2-(trifluoromethyl)phenyl]pyridine |
| SMILES | Fc1c(-c2ccccc2C(F)(F)F)cncc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H10F7N/c20-17-13(11-5-1-3-7-15(11)18(21,22)23)9-27-10-14(17)12-6-2-4-8-16(12)19(24,25)26/h1-10H |
| InChIKey | VROSWBHMEDJHED-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |