C14H9F4NO2 — CID 133089720
2-[6-fluoro-5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]acetic acid (PubChem CID 133089720) has the molecular formula C14H9F4NO2 and a molecular weight of 299.22 g/mol. Its IUPAC name is 2-[6-fluoro-5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]acetic acid.
| Compound Name | 2-[6-fluoro-5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 133089720 |
| Molecular Formula | C14H9F4NO2 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-[6-fluoro-5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2ccc(C(F)(F)F)cc2)c(F)n1 |
| InChI | InChI=1S/C14H9F4NO2/c15-13-11(6-5-10(19-13)7-12(20)21)8-1-3-9(4-2-8)14(16,17)18/h1-6H,7H2,(H,20,21) |
| InChIKey | QPQZXAQTIXBFBP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|