C11H4Cl5FN2 — CID 133089918
2-fluoro-5-(2,3,4,5,6-pentachlorophenyl)pyridin-3-amine (PubChem CID 133089918) has the molecular formula C11H4Cl5FN2 and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-fluoro-5-(2,3,4,5,6-pentachlorophenyl)pyridin-3-amine.
| Compound Name | 2-fluoro-5-(2,3,4,5,6-pentachlorophenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 133089918 |
| Molecular Formula | C11H4Cl5FN2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 357.88 |
| IUPAC Name | 2-fluoro-5-(2,3,4,5,6-pentachlorophenyl)pyridin-3-amine |
| SMILES | Nc1cc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cnc1F |
| InChI | InChI=1S/C11H4Cl5FN2/c12-6-5(3-1-4(18)11(17)19-2-3)7(13)9(15)10(16)8(6)14/h1-2H,18H2 |
| InChIKey | IJDYCYRJVBFXIB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|