C12H3Cl5FNO2 — CID 133089990
5-fluoro-2-(2,3,4,5,6-pentachlorophenyl)pyridine-3-carboxylic acid (PubChem CID 133089990) has the molecular formula C12H3Cl5FNO2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 5-fluoro-2-(2,3,4,5,6-pentachlorophenyl)pyridine-3-carboxylic acid.
| Compound Name | 5-fluoro-2-(2,3,4,5,6-pentachlorophenyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 133089990 |
| Molecular Formula | C12H3Cl5FNO2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 386.86 |
| IUPAC Name | 5-fluoro-2-(2,3,4,5,6-pentachlorophenyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(F)cnc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H3Cl5FNO2/c13-6-5(7(14)9(16)10(17)8(6)15)11-4(12(20)21)1-3(18)2-19-11/h1-2H,(H,20,21) |
| InChIKey | OMISFDYHAONJGX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|