C11Cl5F4N — CID 133090102
2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentachlorophenyl)pyridine (PubChem CID 133090102) has the molecular formula C11Cl5F4N and a molecular weight of 399.39 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentachlorophenyl)pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentachlorophenyl)pyridine |
|---|---|
| PubChem CID | 133090102 |
| Molecular Formula | C11Cl5F4N |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 396.84 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentachlorophenyl)pyridine |
| SMILES | Fc1nc(F)c(F)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1F |
| InChI | InChI=1S/C11Cl5F4N/c12-3-1(4(13)6(15)7(16)5(3)14)2-8(17)10(19)21-11(20)9(2)18 |
| InChIKey | PYMYNNPMUUVCFR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|