C11H3Cl5FNO — CID 133092106
3-fluoro-4-(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one (PubChem CID 133092106) has the molecular formula C11H3Cl5FNO and a molecular weight of 361.41 g/mol. Its IUPAC name is 3-fluoro-4-(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one.
| Compound Name | 3-fluoro-4-(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133092106 |
| Molecular Formula | C11H3Cl5FNO |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 358.86 |
| IUPAC Name | 3-fluoro-4-(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]ccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1F |
| InChI | InChI=1S/C11H3Cl5FNO/c12-5-4(3-1-2-18-11(19)10(3)17)6(13)8(15)9(16)7(5)14/h1-2H,(H,18,19) |
| InChIKey | IDUOFAPRAGRRRT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|