About 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol
6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol (PubChem CID 133092229) has the molecular formula C11H5Cl3FNO
and a molecular weight of 292.52 g/mol. Its IUPAC name is 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol.
Molecular Properties
| Compound Name | 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol |
| PubChem CID | 133092229 |
| Molecular Formula | C11H5Cl3FNO |
| Molecular Weight | 292.52 g/mol |
| Exact Mass | 290.94 |
| IUPAC Name | 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol |
| SMILES | Oc1cnc(F)cc1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H5Cl3FNO/c12-7-2-1-5(10(13)11(7)14)6-3-9(15)16-4-8(6)17/h1-4,17H |
| InChIKey | UHRYQGAYQBNKDG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol?
The IUPAC name of 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol (CID 133092229) is 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol.
What is the SMILES notation for 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol?
The canonical SMILES for 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol is Oc1cnc(F)cc1-c1ccc(Cl)c(Cl)c1Cl.
What is the InChIKey of 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol?
The InChIKey is UHRYQGAYQBNKDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Cl3FNO/c12-7-2-1-5(10(13)11(7)14)6-3-9(15)16-4-8(6)17/h1-4,17H.
What are the key properties of 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol?
6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol has a molecular weight of 292.52 g/mol, XLogP of 4.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-4-(2,3,4-trichlorophenyl)pyridin-3-ol is sourced from PubChem (CID 133092229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).