C11H5Cl3FNO — CID 133092241
3-fluoro-5-(2,3,4-trichlorophenyl)-1H-pyridin-4-one (PubChem CID 133092241) has the molecular formula C11H5Cl3FNO and a molecular weight of 292.52 g/mol. Its IUPAC name is 3-fluoro-5-(2,3,4-trichlorophenyl)-1H-pyridin-4-one.
| Compound Name | 3-fluoro-5-(2,3,4-trichlorophenyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 133092241 |
| Molecular Formula | C11H5Cl3FNO |
| Molecular Weight | 292.52 g/mol |
| Exact Mass | 290.94 |
| IUPAC Name | 3-fluoro-5-(2,3,4-trichlorophenyl)-1H-pyridin-4-one |
| SMILES | O=c1c(F)c[nH]cc1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H5Cl3FNO/c12-7-2-1-5(9(13)10(7)14)6-3-16-4-8(15)11(6)17/h1-4H,(H,16,17) |
| InChIKey | IZCBGJVYJQGCKO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|