C6H12O5S — CID 13309259
(2R,3S,4R,5S)-2-(hydroxymethyl)thiane-2,3,4,5-tetrol (PubChem CID 13309259) has the molecular formula C6H12O5S and a molecular weight of 196.22 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(hydroxymethyl)thiane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4R,5S)-2-(hydroxymethyl)thiane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 13309259 |
| Molecular Formula | C6H12O5S |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (2R,3S,4R,5S)-2-(hydroxymethyl)thiane-2,3,4,5-tetrol |
| SMILES | OC[C@@]1(O)SC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O5S/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4-,5+,6-/m1/s1 |
| InChIKey | VFFBXSDNDMWYPS-ARQDHWQXSA-N |
| XLogP | -2.50 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |