C18H16O6S — CID 13309305
(3,4-dimethyl-2-oxochromen-7-yl) 4-methoxybenzenesulfonate (PubChem CID 13309305) has the molecular formula C18H16O6S and a molecular weight of 360.39 g/mol. Its IUPAC name is (3,4-dimethyl-2-oxochromen-7-yl) 4-methoxybenzenesulfonate.
| Compound Name | (3,4-dimethyl-2-oxochromen-7-yl) 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 13309305 |
| Molecular Formula | C18H16O6S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | (3,4-dimethyl-2-oxochromen-7-yl) 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2ccc3c(C)c(C)c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C18H16O6S/c1-11-12(2)18(19)23-17-10-14(6-9-16(11)17)24-25(20,21)15-7-4-13(22-3)5-8-15/h4-10H,1-3H3 |
| InChIKey | VBPNIRNKMDDCEE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|