About ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate
ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate (PubChem CID 133093322) has the molecular formula C9H9F2NO4
and a molecular weight of 233.17 g/mol. Its IUPAC name is ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate.
Analyze ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate?
The IUPAC name of ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate (CID 133093322) is ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate.
What is the SMILES notation for ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate?
The canonical SMILES for ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate is CCOC(=O)c1c(O)cnc(C(F)F)c1O.
What is the InChIKey of ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate?
The InChIKey is CPQIZJOYNIGEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO4/c1-2-16-9(15)5-4(13)3-12-6(7(5)14)8(10)11/h3,8,13-14H,2H2,1H3.
What are the key properties of ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate?
ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate has a molecular weight of 233.17 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(difluoromethyl)-3,5-dihydroxypyridine-4-carboxylate is sourced from PubChem (CID 133093322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).