C9H10F2N2O3 — CID 133093498
methyl 2-[4-amino-2-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate (PubChem CID 133093498) has the molecular formula C9H10F2N2O3 and a molecular weight of 232.19 g/mol. Its IUPAC name is methyl 2-[4-amino-2-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate.
| Compound Name | methyl 2-[4-amino-2-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133093498 |
| Molecular Formula | C9H10F2N2O3 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | methyl 2-[4-amino-2-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1c(C(F)F)ncc(O)c1N |
| InChI | InChI=1S/C9H10F2N2O3/c1-16-6(15)2-4-7(12)5(14)3-13-8(4)9(10)11/h3,9,14H,2H2,1H3,(H2,12,13) |
| InChIKey | JWDVQXZFWOIUMB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |