C13H8F5NO2 — CID 133093703
[5-methoxy-6-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]methanol (PubChem CID 133093703) has the molecular formula C13H8F5NO2 and a molecular weight of 305.20 g/mol. Its IUPAC name is [5-methoxy-6-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]methanol.
| Compound Name | [5-methoxy-6-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 133093703 |
| Molecular Formula | C13H8F5NO2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [5-methoxy-6-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]methanol |
| SMILES | COc1ccc(CO)nc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H8F5NO2/c1-21-6-3-2-5(4-20)19-13(6)7-8(14)10(16)12(18)11(17)9(7)15/h2-3,20H,4H2,1H3 |
| InChIKey | OADHVLVAIJLYGY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|