About [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol
[2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol (PubChem CID 133093716) has the molecular formula C18H11F4NO
and a molecular weight of 333.28 g/mol. Its IUPAC name is [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol.
Molecular Properties
| Compound Name | [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol |
| PubChem CID | 133093716 |
| Molecular Formula | C18H11F4NO |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol |
| SMILES | OCc1cc(-c2cccc(F)c2F)nc(-c2cccc(F)c2F)c1 |
| InChI | InChI=1S/C18H11F4NO/c19-13-5-1-3-11(17(13)21)15-7-10(9-24)8-16(23-15)12-4-2-6-14(20)18(12)22/h1-8,24H,9H2 |
| InChIKey | DJLJUTSIFFSHOI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol?
The IUPAC name of [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol (CID 133093716) is [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol.
What is the SMILES notation for [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol?
The canonical SMILES for [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol is OCc1cc(-c2cccc(F)c2F)nc(-c2cccc(F)c2F)c1.
What is the InChIKey of [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol?
The InChIKey is DJLJUTSIFFSHOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F4NO/c19-13-5-1-3-11(17(13)21)15-7-10(9-24)8-16(23-15)12-4-2-6-14(20)18(12)22/h1-8,24H,9H2.
What are the key properties of [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol?
[2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol has a molecular weight of 333.28 g/mol, XLogP of 4.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis(2,3-difluorophenyl)-4-pyridinyl]methanol is sourced from PubChem (CID 133093716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).