C15H11F3N2O2 — CID 133094237
2-[2-methoxy-5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]acetonitrile (PubChem CID 133094237) has the molecular formula C15H11F3N2O2 and a molecular weight of 308.26 g/mol. Its IUPAC name is 2-[2-methoxy-5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]acetonitrile.
| Compound Name | 2-[2-methoxy-5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 133094237 |
| Molecular Formula | C15H11F3N2O2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-[2-methoxy-5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]acetonitrile |
| SMILES | COc1ncc(-c2ccc(OC(F)(F)F)cc2)cc1CC#N |
| InChI | InChI=1S/C15H11F3N2O2/c1-21-14-11(6-7-19)8-12(9-20-14)10-2-4-13(5-3-10)22-15(16,17)18/h2-5,8-9H,6H2,1H3 |
| InChIKey | WNPZYLUMHKWATE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |