C8H5F6NO — CID 133095141
2-methoxy-3,4-bis(trifluoromethyl)pyridine (PubChem CID 133095141) has the molecular formula C8H5F6NO and a molecular weight of 245.12 g/mol. Its IUPAC name is 2-methoxy-3,4-bis(trifluoromethyl)pyridine.
| Compound Name | 2-methoxy-3,4-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 133095141 |
| Molecular Formula | C8H5F6NO |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 2-methoxy-3,4-bis(trifluoromethyl)pyridine |
| SMILES | COc1nccc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C8H5F6NO/c1-16-6-5(8(12,13)14)4(2-3-15-6)7(9,10)11/h2-3H,1H3 |
| InChIKey | AFKRMCIGCVGKFG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |