C7H5F3N4O — CID 133095435
2,4-diamino-6-(trifluoromethoxy)pyridine-3-carbonitrile (PubChem CID 133095435) has the molecular formula C7H5F3N4O and a molecular weight of 218.14 g/mol. Its IUPAC name is 2,4-diamino-6-(trifluoromethoxy)pyridine-3-carbonitrile.
| Compound Name | 2,4-diamino-6-(trifluoromethoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133095435 |
| Molecular Formula | C7H5F3N4O |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 2,4-diamino-6-(trifluoromethoxy)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N)cc(OC(F)(F)F)nc1N |
| InChI | InChI=1S/C7H5F3N4O/c8-7(9,10)15-5-1-4(12)3(2-11)6(13)14-5/h1H,(H4,12,13,14) |
| InChIKey | KETFXUQHNHIUID-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |