C9H6F3N3O3 — CID 133096940
methyl 2-amino-6-cyano-5-(trifluoromethoxy)pyridine-3-carboxylate (PubChem CID 133096940) has the molecular formula C9H6F3N3O3 and a molecular weight of 261.16 g/mol. Its IUPAC name is methyl 2-amino-6-cyano-5-(trifluoromethoxy)pyridine-3-carboxylate.
| Compound Name | methyl 2-amino-6-cyano-5-(trifluoromethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133096940 |
| Molecular Formula | C9H6F3N3O3 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | methyl 2-amino-6-cyano-5-(trifluoromethoxy)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(OC(F)(F)F)c(C#N)nc1N |
| InChI | InChI=1S/C9H6F3N3O3/c1-17-8(16)4-2-6(18-9(10,11)12)5(3-13)15-7(4)14/h2H,1H3,(H2,14,15) |
| InChIKey | PDVXNLAUQHCMER-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |