About butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate
butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate (PubChem CID 13309734) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate.
Molecular Properties
| Compound Name | butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate |
| PubChem CID | 13309734 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate |
| SMILES | CCCCOC(=O)C1(C)CCC=C(C)O1 |
| InChI | InChI=1S/C12H20O3/c1-4-5-9-14-11(13)12(3)8-6-7-10(2)15-12/h7H,4-6,8-9H2,1-3H3 |
| InChIKey | JWEXWLXIFVMELC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate?
The IUPAC name of butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate (CID 13309734) is butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate.
What is the SMILES notation for butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate?
The canonical SMILES for butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate is CCCCOC(=O)C1(C)CCC=C(C)O1.
What is the InChIKey of butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate?
The InChIKey is JWEXWLXIFVMELC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-4-5-9-14-11(13)12(3)8-6-7-10(2)15-12/h7H,4-6,8-9H2,1-3H3.
What are the key properties of butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate?
butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate has a molecular weight of 212.29 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2,6-dimethyl-3,4-dihydropyran-2-carboxylate is sourced from PubChem (CID 13309734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).