C10H7F5N2O — CID 133098420
2-[2-(difluoromethyl)-6-methoxy-5-(trifluoromethyl)-3-pyridinyl]acetonitrile (PubChem CID 133098420) has the molecular formula C10H7F5N2O and a molecular weight of 266.17 g/mol. Its IUPAC name is 2-[2-(difluoromethyl)-6-methoxy-5-(trifluoromethyl)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[2-(difluoromethyl)-6-methoxy-5-(trifluoromethyl)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 133098420 |
| Molecular Formula | C10H7F5N2O |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[2-(difluoromethyl)-6-methoxy-5-(trifluoromethyl)-3-pyridinyl]acetonitrile |
| SMILES | COc1nc(C(F)F)c(CC#N)cc1C(F)(F)F |
| InChI | InChI=1S/C10H7F5N2O/c1-18-9-6(10(13,14)15)4-5(2-3-16)7(17-9)8(11)12/h4,8H,2H2,1H3 |
| InChIKey | XJGUERYCXWOXRS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |