C11H14F2N2O2 — CID 133098516
ethyl 2-(aminomethyl)-4-(difluoromethyl)-5-methylpyridine-3-carboxylate (PubChem CID 133098516) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-4-(difluoromethyl)-5-methylpyridine-3-carboxylate.
| Compound Name | ethyl 2-(aminomethyl)-4-(difluoromethyl)-5-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 133098516 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | ethyl 2-(aminomethyl)-4-(difluoromethyl)-5-methylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN)ncc(C)c1C(F)F |
| InChI | InChI=1S/C11H14F2N2O2/c1-3-17-11(16)9-7(4-14)15-5-6(2)8(9)10(12)13/h5,10H,3-4,14H2,1-2H3 |
| InChIKey | XIATYUHOZXVTBK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |