C16H18NOP — CID 13309972
(2R,4S,5R)-3,4-dimethyl-2,5-diphenyl-1,3,2-oxazaphospholidine (PubChem CID 13309972) has the molecular formula C16H18NOP and a molecular weight of 271.30 g/mol. Its IUPAC name is (2R,4S,5R)-3,4-dimethyl-2,5-diphenyl-1,3,2-oxazaphospholidine.
| Compound Name | (2R,4S,5R)-3,4-dimethyl-2,5-diphenyl-1,3,2-oxazaphospholidine |
|---|---|
| PubChem CID | 13309972 |
| Molecular Formula | C16H18NOP |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (2R,4S,5R)-3,4-dimethyl-2,5-diphenyl-1,3,2-oxazaphospholidine |
| SMILES | C[C@H]1[C@@H](c2ccccc2)O[P@](c2ccccc2)N1C |
| InChI | InChI=1S/C16H18NOP/c1-13-16(14-9-5-3-6-10-14)18-19(17(13)2)15-11-7-4-8-12-15/h3-13,16H,1-2H3/t13-,16-,19+/m0/s1 |
| InChIKey | GILFEOIOULSTAS-IYJAJMOOSA-N |
| XLogP | 3.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|