C9H8F5NO — CID 133100071
5-(difluoromethyl)-3-methoxy-2-methyl-6-(trifluoromethyl)pyridine (PubChem CID 133100071) has the molecular formula C9H8F5NO and a molecular weight of 241.16 g/mol. Its IUPAC name is 5-(difluoromethyl)-3-methoxy-2-methyl-6-(trifluoromethyl)pyridine.
| Compound Name | 5-(difluoromethyl)-3-methoxy-2-methyl-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 133100071 |
| Molecular Formula | C9H8F5NO |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 5-(difluoromethyl)-3-methoxy-2-methyl-6-(trifluoromethyl)pyridine |
| SMILES | COc1cc(C(F)F)c(C(F)(F)F)nc1C |
| InChI | InChI=1S/C9H8F5NO/c1-4-6(16-2)3-5(8(10)11)7(15-4)9(12,13)14/h3,8H,1-2H3 |
| InChIKey | WRRLIYNXNPEHLQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |