C10H9BrF2INO2 — CID 133100576
ethyl 3-(bromomethyl)-6-(difluoromethyl)-5-iodopyridine-2-carboxylate (PubChem CID 133100576) has the molecular formula C10H9BrF2INO2 and a molecular weight of 419.99 g/mol. Its IUPAC name is ethyl 3-(bromomethyl)-6-(difluoromethyl)-5-iodopyridine-2-carboxylate.
| Compound Name | ethyl 3-(bromomethyl)-6-(difluoromethyl)-5-iodopyridine-2-carboxylate |
|---|---|
| PubChem CID | 133100576 |
| Molecular Formula | C10H9BrF2INO2 |
| Molecular Weight | 419.99 g/mol |
| Exact Mass | 418.88 |
| IUPAC Name | ethyl 3-(bromomethyl)-6-(difluoromethyl)-5-iodopyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C(F)F)c(I)cc1CBr |
| InChI | InChI=1S/C10H9BrF2INO2/c1-2-17-10(16)7-5(4-11)3-6(14)8(15-7)9(12)13/h3,9H,2,4H2,1H3 |
| InChIKey | AKLZUXKCZOXPFZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.99 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|