C11H13F2IN2O2 — CID 133100614
ethyl 2-[4-(aminomethyl)-5-(difluoromethyl)-6-iodo-3-pyridinyl]acetate (PubChem CID 133100614) has the molecular formula C11H13F2IN2O2 and a molecular weight of 370.14 g/mol. Its IUPAC name is ethyl 2-[4-(aminomethyl)-5-(difluoromethyl)-6-iodo-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[4-(aminomethyl)-5-(difluoromethyl)-6-iodo-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133100614 |
| Molecular Formula | C11H13F2IN2O2 |
| Molecular Weight | 370.14 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | ethyl 2-[4-(aminomethyl)-5-(difluoromethyl)-6-iodo-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cnc(I)c(C(F)F)c1CN |
| InChI | InChI=1S/C11H13F2IN2O2/c1-2-18-8(17)3-6-5-16-11(14)9(10(12)13)7(6)4-15/h5,10H,2-4,15H2,1H3 |
| InChIKey | ODMKUKPQVIQKRD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.14 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|