C10H10ClF2NO3 — CID 133101974
methyl 2-[6-(chloromethyl)-4-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate (PubChem CID 133101974) has the molecular formula C10H10ClF2NO3 and a molecular weight of 265.64 g/mol. Its IUPAC name is methyl 2-[6-(chloromethyl)-4-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate.
| Compound Name | methyl 2-[6-(chloromethyl)-4-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133101974 |
| Molecular Formula | C10H10ClF2NO3 |
| Molecular Weight | 265.64 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | methyl 2-[6-(chloromethyl)-4-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cnc(CCl)c(O)c1C(F)F |
| InChI | InChI=1S/C10H10ClF2NO3/c1-17-7(15)2-5-4-14-6(3-11)9(16)8(5)10(12)13/h4,10,16H,2-3H2,1H3 |
| InChIKey | VIISLJPQXLKPLJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.64 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|