C10H10F2N2O5 — CID 133103191
ethyl 2-[5-(difluoromethyl)-6-nitro-2-oxo-1H-pyridin-3-yl]acetate (PubChem CID 133103191) has the molecular formula C10H10F2N2O5 and a molecular weight of 276.20 g/mol. Its IUPAC name is ethyl 2-[5-(difluoromethyl)-6-nitro-2-oxo-1H-pyridin-3-yl]acetate.
| Compound Name | ethyl 2-[5-(difluoromethyl)-6-nitro-2-oxo-1H-pyridin-3-yl]acetate |
|---|---|
| PubChem CID | 133103191 |
| Molecular Formula | C10H10F2N2O5 |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | ethyl 2-[5-(difluoromethyl)-6-nitro-2-oxo-1H-pyridin-3-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(C(F)F)c([N+](=O)[O-])[nH]c1=O |
| InChI | InChI=1S/C10H10F2N2O5/c1-2-19-7(15)4-5-3-6(8(11)12)9(14(17)18)13-10(5)16/h3,8H,2,4H2,1H3,(H,13,16) |
| InChIKey | JCYIQDPIBPZVET-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|