C9H3F5N2O — CID 133106396
4-(difluoromethyl)-5-formyl-6-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 133106396) has the molecular formula C9H3F5N2O and a molecular weight of 250.13 g/mol. Its IUPAC name is 4-(difluoromethyl)-5-formyl-6-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 4-(difluoromethyl)-5-formyl-6-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133106396 |
| Molecular Formula | C9H3F5N2O |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 4-(difluoromethyl)-5-formyl-6-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(C(F)F)c(C=O)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H3F5N2O/c10-8(11)5-1-4(2-15)16-7(6(5)3-17)9(12,13)14/h1,3,8H |
| InChIKey | PBSVUVOHOSTLBP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|