C10H7ClF2N2O2 — CID 133106509
2-[6-(chloromethyl)-4-cyano-2-(difluoromethyl)-3-pyridinyl]acetic acid (PubChem CID 133106509) has the molecular formula C10H7ClF2N2O2 and a molecular weight of 260.63 g/mol. Its IUPAC name is 2-[6-(chloromethyl)-4-cyano-2-(difluoromethyl)-3-pyridinyl]acetic acid.
| Compound Name | 2-[6-(chloromethyl)-4-cyano-2-(difluoromethyl)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 133106509 |
| Molecular Formula | C10H7ClF2N2O2 |
| Molecular Weight | 260.63 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 2-[6-(chloromethyl)-4-cyano-2-(difluoromethyl)-3-pyridinyl]acetic acid |
| SMILES | N#Cc1cc(CCl)nc(C(F)F)c1CC(=O)O |
| InChI | InChI=1S/C10H7ClF2N2O2/c11-3-6-1-5(4-14)7(2-8(16)17)9(15-6)10(12)13/h1,10H,2-3H2,(H,16,17) |
| InChIKey | FCSWRYPLMOUSCO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.63 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|