C11H9ClF2N2O2 — CID 133107022
ethyl 2-(chloromethyl)-6-cyano-4-(difluoromethyl)pyridine-3-carboxylate (PubChem CID 133107022) has the molecular formula C11H9ClF2N2O2 and a molecular weight of 274.65 g/mol. Its IUPAC name is ethyl 2-(chloromethyl)-6-cyano-4-(difluoromethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 2-(chloromethyl)-6-cyano-4-(difluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133107022 |
| Molecular Formula | C11H9ClF2N2O2 |
| Molecular Weight | 274.65 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | ethyl 2-(chloromethyl)-6-cyano-4-(difluoromethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)F)cc(C#N)nc1CCl |
| InChI | InChI=1S/C11H9ClF2N2O2/c1-2-18-11(17)9-7(10(13)14)3-6(5-15)16-8(9)4-12/h3,10H,2,4H2,1H3 |
| InChIKey | CDSMANHGCBDHLC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|