About 2,3-dimethoxy-1,2-dihydropyrrol-5-one
2,3-dimethoxy-1,2-dihydropyrrol-5-one (PubChem CID 13310793) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 2,3-dimethoxy-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 2,3-dimethoxy-1,2-dihydropyrrol-5-one |
| PubChem CID | 13310793 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 2,3-dimethoxy-1,2-dihydropyrrol-5-one |
| SMILES | COC1=CC(=O)NC1OC |
| InChI | InChI=1S/C6H9NO3/c1-9-4-3-5(8)7-6(4)10-2/h3,6H,1-2H3,(H,7,8) |
| InChIKey | UXIXCJMAQFTAEW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethoxy-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxy-1,2-dihydropyrrol-5-one?
The IUPAC name of 2,3-dimethoxy-1,2-dihydropyrrol-5-one (CID 13310793) is 2,3-dimethoxy-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 2,3-dimethoxy-1,2-dihydropyrrol-5-one?
The canonical SMILES for 2,3-dimethoxy-1,2-dihydropyrrol-5-one is COC1=CC(=O)NC1OC.
What is the InChIKey of 2,3-dimethoxy-1,2-dihydropyrrol-5-one?
The InChIKey is UXIXCJMAQFTAEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-9-4-3-5(8)7-6(4)10-2/h3,6H,1-2H3,(H,7,8).
What are the key properties of 2,3-dimethoxy-1,2-dihydropyrrol-5-one?
2,3-dimethoxy-1,2-dihydropyrrol-5-one has a molecular weight of 143.14 g/mol, XLogP of -0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 13310793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).