C15H16FN5O — CID 133108099
5-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)triazolidine-4-carboxamide (PubChem CID 133108099) has the molecular formula C15H16FN5O and a molecular weight of 301.32 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)triazolidine-4-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)triazolidine-4-carboxamide |
|---|---|
| PubChem CID | 133108099 |
| Molecular Formula | C15H16FN5O |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)triazolidine-4-carboxamide |
| SMILES | O=C(NCc1ccccn1)C1NNNC1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H16FN5O/c16-11-6-4-10(5-7-11)13-14(20-21-19-13)15(22)18-9-12-3-1-2-8-17-12/h1-8,13-14,19-21H,9H2,(H,18,22) |
| InChIKey | XJWJNDQEEFPSPM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |