C17H21N7O2S — CID 133108242
N-[4-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-6-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]pyrimidine-2-carboxamide (PubChem CID 133108242) has the molecular formula C17H21N7O2S and a molecular weight of 387.47 g/mol. Its IUPAC name is N-[4-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-6-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]pyrimidine-2-carboxamide.
| Compound Name | N-[4-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-6-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 133108242 |
| Molecular Formula | C17H21N7O2S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-[4-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-6-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]pyrimidine-2-carboxamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ncccn2)n1)NC1CCC2CNNC2C1 |
| InChI | InChI=1S/C17H21N7O2S/c25-14(21-11-3-2-10-8-20-24-13(10)6-11)7-12-9-27-17(22-12)23-16(26)15-18-4-1-5-19-15/h1,4-5,9-11,13,20,24H,2-3,6-8H2,(H,21,25)(H,22,23,26) |
| InChIKey | KSFOPKRSUGEYMJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |